About benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate
benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate (PubChem CID 3222952) has the molecular formula C26H23FN2O5
and a molecular weight of 462.48 g/mol. Its IUPAC name is benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate |
| PubChem CID | 3222952 |
| Molecular Formula | C26H23FN2O5 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate |
| SMILES | CC1(C)Oc2ccc(C(=O)Nc3ccccc3F)cc2N(CC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H23FN2O5/c1-26(2)25(32)29(15-23(30)33-16-17-8-4-3-5-9-17)21-14-18(12-13-22(21)34-26)24(31)28-20-11-7-6-10-19(20)27/h3-14H,15-16H2,1-2H3,(H,28,31) |
| InChIKey | MWTFCHNZHCDTDN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate?
The IUPAC name of benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate (CID 3222952) is benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate.
What is the SMILES notation for benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate?
The canonical SMILES for benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate is CC1(C)Oc2ccc(C(=O)Nc3ccccc3F)cc2N(CC(=O)OCc2ccccc2)C1=O.
What is the InChIKey of benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate?
The InChIKey is MWTFCHNZHCDTDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23FN2O5/c1-26(2)25(32)29(15-23(30)33-16-17-8-4-3-5-9-17)21-14-18(12-13-22(21)34-26)24(31)28-20-11-7-6-10-19(20)27/h3-14H,15-16H2,1-2H3,(H,28,31).
What are the key properties of benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate?
benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate has a molecular weight of 462.48 g/mol, XLogP of 4.33, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[6-[(2-fluorophenyl)carbamoyl]-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate is sourced from PubChem (CID 3222952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).