C26H30N2O5 — CID 3222917
benzyl 2-[6-(cyclohexylcarbamoyl)-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate (PubChem CID 3222917) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is benzyl 2-[6-(cyclohexylcarbamoyl)-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate.
| Compound Name | benzyl 2-[6-(cyclohexylcarbamoyl)-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate |
|---|---|
| PubChem CID | 3222917 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | benzyl 2-[6-(cyclohexylcarbamoyl)-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl]acetate |
| SMILES | CC1(C)Oc2ccc(C(=O)NC3CCCCC3)cc2N(CC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H30N2O5/c1-26(2)25(31)28(16-23(29)32-17-18-9-5-3-6-10-18)21-15-19(13-14-22(21)33-26)24(30)27-20-11-7-4-8-12-20/h3,5-6,9-10,13-15,20H,4,7-8,11-12,16-17H2,1-2H3,(H,27,30) |
| InChIKey | YUPJOEPHWNZCFV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |