C17H23N3O3 — CID 28815931
2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N-cyclopentylacetamide (PubChem CID 28815931) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N-cyclopentylacetamide.
| Compound Name | 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 28815931 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)-N-cyclopentylacetamide |
| SMILES | CC1(C)Oc2cc(N)ccc2N(CC(=O)NC2CCCC2)C1=O |
| InChI | InChI=1S/C17H23N3O3/c1-17(2)16(22)20(10-15(21)19-12-5-3-4-6-12)13-8-7-11(18)9-14(13)23-17/h7-9,12H,3-6,10,18H2,1-2H3,(H,19,21) |
| InChIKey | JZCMMNUQWMVAER-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|