C16H21N3O4 — CID 28815945
7-amino-2,2-dimethyl-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzoxazin-3-one (PubChem CID 28815945) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 7-amino-2,2-dimethyl-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-2,2-dimethyl-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28815945 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 7-amino-2,2-dimethyl-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2cc(N)ccc2N(CC(=O)N2CCOCC2)C1=O |
| InChI | InChI=1S/C16H21N3O4/c1-16(2)15(21)19(10-14(20)18-5-7-22-8-6-18)12-4-3-11(17)9-13(12)23-16/h3-4,9H,5-8,10,17H2,1-2H3 |
| InChIKey | ANRUIKXVAFCTKO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|