C19H18ClNO3 — CID 28816147
4-benzyl-6-(2-chloroacetyl)-2,2-dimethyl-1,4-benzoxazin-3-one (PubChem CID 28816147) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is 4-benzyl-6-(2-chloroacetyl)-2,2-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | 4-benzyl-6-(2-chloroacetyl)-2,2-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28816147 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4-benzyl-6-(2-chloroacetyl)-2,2-dimethyl-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2ccc(C(=O)CCl)cc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C19H18ClNO3/c1-19(2)18(23)21(12-13-6-4-3-5-7-13)15-10-14(16(22)11-20)8-9-17(15)24-19/h3-10H,11-12H2,1-2H3 |
| InChIKey | WSRLCMRCXHSTPX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|