C18H23ClN2O4 — CID 28816091
6-(2-chloroacetyl)-2,2-dimethyl-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one (PubChem CID 28816091) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is 6-(2-chloroacetyl)-2,2-dimethyl-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-chloroacetyl)-2,2-dimethyl-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28816091 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 6-(2-chloroacetyl)-2,2-dimethyl-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2ccc(C(=O)CCl)cc2N(CCN2CCOCC2)C1=O |
| InChI | InChI=1S/C18H23ClN2O4/c1-18(2)17(23)21(6-5-20-7-9-24-10-8-20)14-11-13(15(22)12-19)3-4-16(14)25-18/h3-4,11H,5-10,12H2,1-2H3 |
| InChIKey | VNXGLZPPOCKWLD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|