C16H20ClNO4 — CID 82162474
6-(2-chloroacetyl)-2,2-diethyl-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one (PubChem CID 82162474) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is 6-(2-chloroacetyl)-2,2-diethyl-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-chloroacetyl)-2,2-diethyl-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82162474 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 6-(2-chloroacetyl)-2,2-diethyl-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one |
| SMILES | CCC1(CC)Oc2ccc(C(=O)CCl)cc2N(CCO)C1=O |
| InChI | InChI=1S/C16H20ClNO4/c1-3-16(4-2)15(21)18(7-8-19)12-9-11(13(20)10-17)5-6-14(12)22-16/h5-6,9,19H,3-4,7-8,10H2,1-2H3 |
| InChIKey | AKJLVDKALBHJRB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|