C14H17NO5 — CID 82162315
2-(2,2-diethyl-6-hydroxy-3-oxo-1,4-benzoxazin-4-yl)acetic acid (PubChem CID 82162315) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-(2,2-diethyl-6-hydroxy-3-oxo-1,4-benzoxazin-4-yl)acetic acid.
| Compound Name | 2-(2,2-diethyl-6-hydroxy-3-oxo-1,4-benzoxazin-4-yl)acetic acid |
|---|---|
| PubChem CID | 82162315 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-(2,2-diethyl-6-hydroxy-3-oxo-1,4-benzoxazin-4-yl)acetic acid |
| SMILES | CCC1(CC)Oc2ccc(O)cc2N(CC(=O)O)C1=O |
| InChI | InChI=1S/C14H17NO5/c1-3-14(4-2)13(19)15(8-12(17)18)10-7-9(16)5-6-11(10)20-14/h5-7,16H,3-4,8H2,1-2H3,(H,17,18) |
| InChIKey | VPYVTJXCFCKPIA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |