C16H24N2O3 — CID 82162660
4-(2-aminobutyl)-2,2-diethyl-6-hydroxy-1,4-benzoxazin-3-one (PubChem CID 82162660) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-(2-aminobutyl)-2,2-diethyl-6-hydroxy-1,4-benzoxazin-3-one.
| Compound Name | 4-(2-aminobutyl)-2,2-diethyl-6-hydroxy-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82162660 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-(2-aminobutyl)-2,2-diethyl-6-hydroxy-1,4-benzoxazin-3-one |
| SMILES | CCC(N)CN1C(=O)C(CC)(CC)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C16H24N2O3/c1-4-11(17)10-18-13-9-12(19)7-8-14(13)21-16(5-2,6-3)15(18)20/h7-9,11,19H,4-6,10,17H2,1-3H3 |
| InChIKey | YJGVPTTUTOIFOT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |