C15H22N2O4 — CID 82162439
7-amino-4-(2,3-dihydroxypropyl)-2,2-diethyl-1,4-benzoxazin-3-one (PubChem CID 82162439) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 7-amino-4-(2,3-dihydroxypropyl)-2,2-diethyl-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-4-(2,3-dihydroxypropyl)-2,2-diethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82162439 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 7-amino-4-(2,3-dihydroxypropyl)-2,2-diethyl-1,4-benzoxazin-3-one |
| SMILES | CCC1(CC)Oc2cc(N)ccc2N(CC(O)CO)C1=O |
| InChI | InChI=1S/C15H22N2O4/c1-3-15(4-2)14(20)17(8-11(19)9-18)12-6-5-10(16)7-13(12)21-15/h5-7,11,18-19H,3-4,8-9,16H2,1-2H3 |
| InChIKey | NVZDJJBNZZEYOT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|