C16H22N2O3 — CID 82162369
6-amino-2,2-diethyl-4-(3-oxobutan-2-yl)-1,4-benzoxazin-3-one (PubChem CID 82162369) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 6-amino-2,2-diethyl-4-(3-oxobutan-2-yl)-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-2,2-diethyl-4-(3-oxobutan-2-yl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82162369 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 6-amino-2,2-diethyl-4-(3-oxobutan-2-yl)-1,4-benzoxazin-3-one |
| SMILES | CCC1(CC)Oc2ccc(N)cc2N(C(C)C(C)=O)C1=O |
| InChI | InChI=1S/C16H22N2O3/c1-5-16(6-2)15(20)18(10(3)11(4)19)13-9-12(17)7-8-14(13)21-16/h7-10H,5-6,17H2,1-4H3 |
| InChIKey | XLVYNGMMROUVJE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|