C22H23N3O6 — CID 1450875
2,2-dimethyl-6-(morpholine-4-carbonyl)-4-[(4-nitrophenyl)methyl]-1,4-benzoxazin-3-one (PubChem CID 1450875) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2,2-dimethyl-6-(morpholine-4-carbonyl)-4-[(4-nitrophenyl)methyl]-1,4-benzoxazin-3-one.
| Compound Name | 2,2-dimethyl-6-(morpholine-4-carbonyl)-4-[(4-nitrophenyl)methyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 1450875 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2,2-dimethyl-6-(morpholine-4-carbonyl)-4-[(4-nitrophenyl)methyl]-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2ccc(C(=O)N3CCOCC3)cc2N(Cc2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C22H23N3O6/c1-22(2)21(27)24(14-15-3-6-17(7-4-15)25(28)29)18-13-16(5-8-19(18)31-22)20(26)23-9-11-30-12-10-23/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | WGIVGQYJZXIZTL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|