C22H24N2O3 — CID 1450828
4-benzyl-2,2-dimethyl-6-(pyrrolidine-1-carbonyl)-1,4-benzoxazin-3-one (PubChem CID 1450828) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-benzyl-2,2-dimethyl-6-(pyrrolidine-1-carbonyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-benzyl-2,2-dimethyl-6-(pyrrolidine-1-carbonyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 1450828 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-benzyl-2,2-dimethyl-6-(pyrrolidine-1-carbonyl)-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2ccc(C(=O)N3CCCC3)cc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C22H24N2O3/c1-22(2)21(26)24(15-16-8-4-3-5-9-16)18-14-17(10-11-19(18)27-22)20(25)23-12-6-7-13-23/h3-5,8-11,14H,6-7,12-13,15H2,1-2H3 |
| InChIKey | YJYQRPRJSABNND-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |