C19H26N2O2S — CID 3223579
4-(4-methylbenzoyl)-N-(oxolan-2-ylmethyl)piperidine-1-carbothioamide (PubChem CID 3223579) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 4-(4-methylbenzoyl)-N-(oxolan-2-ylmethyl)piperidine-1-carbothioamide.
| Compound Name | 4-(4-methylbenzoyl)-N-(oxolan-2-ylmethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3223579 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-(4-methylbenzoyl)-N-(oxolan-2-ylmethyl)piperidine-1-carbothioamide |
| SMILES | Cc1ccc(C(=O)C2CCN(C(=S)NCC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C19H26N2O2S/c1-14-4-6-15(7-5-14)18(22)16-8-10-21(11-9-16)19(24)20-13-17-3-2-12-23-17/h4-7,16-17H,2-3,8-13H2,1H3,(H,20,24) |
| InChIKey | WGRFTNDLTNCLKQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|