C20H26N2O4S — CID 3223583
4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-N-(oxolan-2-ylmethyl)piperidine-1-carbothioamide (PubChem CID 3223583) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-N-(oxolan-2-ylmethyl)piperidine-1-carbothioamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-N-(oxolan-2-ylmethyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3223583 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxine-6-carbonyl)-N-(oxolan-2-ylmethyl)piperidine-1-carbothioamide |
| SMILES | O=C(c1ccc2c(c1)OCCO2)C1CCN(C(=S)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C20H26N2O4S/c23-19(15-3-4-17-18(12-15)26-11-10-25-17)14-5-7-22(8-6-14)20(27)21-13-16-2-1-9-24-16/h3-4,12,14,16H,1-2,5-11,13H2,(H,21,27) |
| InChIKey | KMNSDGBVICGRJH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|