C22H32N4OS — CID 3224048
1-cyclopentyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 3224048) has the molecular formula C22H32N4OS and a molecular weight of 400.59 g/mol. Its IUPAC name is 1-cyclopentyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-cyclopentyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3224048 |
| Molecular Formula | C22H32N4OS |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-cyclopentyl-1-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1cc2nc(CCN(C(=S)NCC3CCCO3)C3CCCC3)[nH]c2cc1C |
| InChI | InChI=1S/C22H32N4OS/c1-15-12-19-20(13-16(15)2)25-21(24-19)9-10-26(17-6-3-4-7-17)22(28)23-14-18-8-5-11-27-18/h12-13,17-18H,3-11,14H2,1-2H3,(H,23,28)(H,24,25) |
| InChIKey | NKMVYFQPPRRHFR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|