C17H13N3OS2 — CID 3225162
4-benzyl-N-(1,3-thiazol-2-yl)thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 3225162) has the molecular formula C17H13N3OS2 and a molecular weight of 339.45 g/mol. Its IUPAC name is 4-benzyl-N-(1,3-thiazol-2-yl)thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-benzyl-N-(1,3-thiazol-2-yl)thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 3225162 |
| Molecular Formula | C17H13N3OS2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 4-benzyl-N-(1,3-thiazol-2-yl)thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cc2sccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C17H13N3OS2/c21-16(19-17-18-7-9-23-17)14-10-15-13(6-8-22-15)20(14)11-12-4-2-1-3-5-12/h1-10H,11H2,(H,18,19,21) |
| InChIKey | AXNUMISAVFJRDM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |