C20H28N2O4S — CID 3227555
N-[2-(tert-butylamino)-1-(furan-2-yl)-2-oxoethyl]-N-cyclopentyl-5-oxothiolane-3-carboxamide (PubChem CID 3227555) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-1-(furan-2-yl)-2-oxoethyl]-N-cyclopentyl-5-oxothiolane-3-carboxamide.
| Compound Name | N-[2-(tert-butylamino)-1-(furan-2-yl)-2-oxoethyl]-N-cyclopentyl-5-oxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 3227555 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[2-(tert-butylamino)-1-(furan-2-yl)-2-oxoethyl]-N-cyclopentyl-5-oxothiolane-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C(c1ccco1)N(C(=O)C1CSC(=O)C1)C1CCCC1 |
| InChI | InChI=1S/C20H28N2O4S/c1-20(2,3)21-18(24)17(15-9-6-10-26-15)22(14-7-4-5-8-14)19(25)13-11-16(23)27-12-13/h6,9-10,13-14,17H,4-5,7-8,11-12H2,1-3H3,(H,21,24) |
| InChIKey | PUKYBVRFECCKNW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|