C24H29N3O3S — CID 3227543
N-[2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]-N-(2,6-dimethylphenyl)-5-oxothiolane-3-carboxamide (PubChem CID 3227543) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]-N-(2,6-dimethylphenyl)-5-oxothiolane-3-carboxamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]-N-(2,6-dimethylphenyl)-5-oxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 3227543 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]-N-(2,6-dimethylphenyl)-5-oxothiolane-3-carboxamide |
| SMILES | Cc1cccc(C)c1N(C(=O)C1CSC(=O)C1)C(C(=O)NC(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C24H29N3O3S/c1-15-9-8-10-16(2)20(15)27(23(30)17-13-19(28)31-14-17)21(18-11-6-7-12-25-18)22(29)26-24(3,4)5/h6-12,17,21H,13-14H2,1-5H3,(H,26,29) |
| InChIKey | GPGRSOPVSJIYNL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|