C22H27ClN4O2 — CID 3231056
N-[2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]-6-chloro-N-cyclopentylpyridine-3-carboxamide (PubChem CID 3231056) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]-6-chloro-N-cyclopentylpyridine-3-carboxamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]-6-chloro-N-cyclopentylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 3231056 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxo-1-pyridin-2-ylethyl]-6-chloro-N-cyclopentylpyridine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C(c1ccccn1)N(C(=O)c1ccc(Cl)nc1)C1CCCC1 |
| InChI | InChI=1S/C22H27ClN4O2/c1-22(2,3)26-20(28)19(17-10-6-7-13-24-17)27(16-8-4-5-9-16)21(29)15-11-12-18(23)25-14-15/h6-7,10-14,16,19H,4-5,8-9H2,1-3H3,(H,26,28) |
| InChIKey | JRLFNNVRQWGMLP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|