C24H27N3O3S — CID 3227547
N-benzyl-N-[2-(cyclopentylamino)-2-oxo-1-pyridin-2-ylethyl]-5-oxothiolane-3-carboxamide (PubChem CID 3227547) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-benzyl-N-[2-(cyclopentylamino)-2-oxo-1-pyridin-2-ylethyl]-5-oxothiolane-3-carboxamide.
| Compound Name | N-benzyl-N-[2-(cyclopentylamino)-2-oxo-1-pyridin-2-ylethyl]-5-oxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 3227547 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-benzyl-N-[2-(cyclopentylamino)-2-oxo-1-pyridin-2-ylethyl]-5-oxothiolane-3-carboxamide |
| SMILES | O=C1CC(C(=O)N(Cc2ccccc2)C(C(=O)NC2CCCC2)c2ccccn2)CS1 |
| InChI | InChI=1S/C24H27N3O3S/c28-21-14-18(16-31-21)24(30)27(15-17-8-2-1-3-9-17)22(20-12-6-7-13-25-20)23(29)26-19-10-4-5-11-19/h1-3,6-9,12-13,18-19,22H,4-5,10-11,14-16H2,(H,26,29) |
| InChIKey | GZOZAZDMYRLUTR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|