C29H33N3O3 — CID 3205958
N-benzyl-N-[2-(cyclohexylamino)-1-(2-ethoxyphenyl)-2-oxoethyl]pyridine-2-carboxamide (PubChem CID 3205958) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-benzyl-N-[2-(cyclohexylamino)-1-(2-ethoxyphenyl)-2-oxoethyl]pyridine-2-carboxamide.
| Compound Name | N-benzyl-N-[2-(cyclohexylamino)-1-(2-ethoxyphenyl)-2-oxoethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 3205958 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | N-benzyl-N-[2-(cyclohexylamino)-1-(2-ethoxyphenyl)-2-oxoethyl]pyridine-2-carboxamide |
| SMILES | CCOc1ccccc1C(C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)c1ccccn1 |
| InChI | InChI=1S/C29H33N3O3/c1-2-35-26-19-10-9-17-24(26)27(28(33)31-23-15-7-4-8-16-23)32(21-22-13-5-3-6-14-22)29(34)25-18-11-12-20-30-25/h3,5-6,9-14,17-20,23,27H,2,4,7-8,15-16,21H2,1H3,(H,31,33) |
| InChIKey | DHRZHQUAZFKOOV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |