C23H24N4O2S — CID 7434931
N-benzyl-N-[(1R)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]thiadiazole-4-carboxamide (PubChem CID 7434931) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is N-benzyl-N-[(1R)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]thiadiazole-4-carboxamide.
| Compound Name | N-benzyl-N-[(1R)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 7434931 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-benzyl-N-[(1R)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]thiadiazole-4-carboxamide |
| SMILES | O=C(NC1CCCC1)[C@@H](c1ccccc1)N(Cc1ccccc1)C(=O)c1csnn1 |
| InChI | InChI=1S/C23H24N4O2S/c28-22(24-19-13-7-8-14-19)21(18-11-5-2-6-12-18)27(15-17-9-3-1-4-10-17)23(29)20-16-30-26-25-20/h1-6,9-12,16,19,21H,7-8,13-15H2,(H,24,28)/t21-/m1/s1 |
| InChIKey | KPDIDBAYMFVZBV-OAQYLSRUSA-N |
| XLogP | 3.98 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |