C19H21FN4O2S — CID 1467762
N-[(1R)-2-(cyclopentylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide (PubChem CID 1467762) has the molecular formula C19H21FN4O2S and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[(1R)-2-(cyclopentylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide.
| Compound Name | N-[(1R)-2-(cyclopentylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 1467762 |
| Molecular Formula | C19H21FN4O2S |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-[(1R)-2-(cyclopentylamino)-1-(4-fluorophenyl)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide |
| SMILES | C=CCN(C(=O)c1csnn1)[C@@H](C(=O)NC1CCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN4O2S/c1-2-11-24(19(26)16-12-27-23-22-16)17(13-7-9-14(20)10-8-13)18(25)21-15-5-3-4-6-15/h2,7-10,12,15,17H,1,3-6,11H2,(H,21,25)/t17-/m1/s1 |
| InChIKey | OOFNOKFSQDDKBH-QGZVFWFLSA-N |
| XLogP | 3.11 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|