C19H17FN4O2S2 — CID 7435179
N-[(1S)-2-[(4-fluorophenyl)methylamino]-2-oxo-1-thiophen-2-ylethyl]-N-prop-2-enylthiadiazole-4-carboxamide (PubChem CID 7435179) has the molecular formula C19H17FN4O2S2 and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[(1S)-2-[(4-fluorophenyl)methylamino]-2-oxo-1-thiophen-2-ylethyl]-N-prop-2-enylthiadiazole-4-carboxamide.
| Compound Name | N-[(1S)-2-[(4-fluorophenyl)methylamino]-2-oxo-1-thiophen-2-ylethyl]-N-prop-2-enylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 7435179 |
| Molecular Formula | C19H17FN4O2S2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-[(1S)-2-[(4-fluorophenyl)methylamino]-2-oxo-1-thiophen-2-ylethyl]-N-prop-2-enylthiadiazole-4-carboxamide |
| SMILES | C=CCN(C(=O)c1csnn1)[C@@H](C(=O)NCc1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C19H17FN4O2S2/c1-2-9-24(19(26)15-12-28-23-22-15)17(16-4-3-10-27-16)18(25)21-11-13-5-7-14(20)8-6-13/h2-8,10,12,17H,1,9,11H2,(H,21,25)/t17-/m1/s1 |
| InChIKey | PYTHHLZJGRHURR-QGZVFWFLSA-N |
| XLogP | 3.42 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|