C19H24N4O2S2 — CID 7435195
N-[(1S)-2-(cyclohexylamino)-1-(3-methylthiophen-2-yl)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide (PubChem CID 7435195) has the molecular formula C19H24N4O2S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N-[(1S)-2-(cyclohexylamino)-1-(3-methylthiophen-2-yl)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide.
| Compound Name | N-[(1S)-2-(cyclohexylamino)-1-(3-methylthiophen-2-yl)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 7435195 |
| Molecular Formula | C19H24N4O2S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[(1S)-2-(cyclohexylamino)-1-(3-methylthiophen-2-yl)-2-oxoethyl]-N-prop-2-enylthiadiazole-4-carboxamide |
| SMILES | C=CCN(C(=O)c1csnn1)[C@@H](C(=O)NC1CCCCC1)c1sccc1C |
| InChI | InChI=1S/C19H24N4O2S2/c1-3-10-23(19(25)15-12-27-22-21-15)16(17-13(2)9-11-26-17)18(24)20-14-7-5-4-6-8-14/h3,9,11-12,14,16H,1,4-8,10H2,2H3,(H,20,24)/t16-/m1/s1 |
| InChIKey | OJNYCMUQTXPWLT-MRXNPFEDSA-N |
| XLogP | 3.73 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|