C17H19N5O3 — CID 3227789
N-(2-methoxyethyl)-2-[1-(4-methylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide (PubChem CID 3227789) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[1-(4-methylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[1-(4-methylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide |
|---|---|
| PubChem CID | 3227789 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-(2-methoxyethyl)-2-[1-(4-methylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]acetamide |
| SMILES | COCCNC(=O)Cn1cnc2c(cnn2-c2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C17H19N5O3/c1-12-3-5-13(6-4-12)22-16-14(9-20-22)17(24)21(11-19-16)10-15(23)18-7-8-25-2/h3-6,9,11H,7-8,10H2,1-2H3,(H,18,23) |
| InChIKey | MWAWPVNIRCCMPB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|