C14H10FN3OS — CID 3228403
N-[(4-fluorophenyl)methylideneamino]-4H-thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 3228403) has the molecular formula C14H10FN3OS and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methylideneamino]-4H-thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methylideneamino]-4H-thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 3228403 |
| Molecular Formula | C14H10FN3OS |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | N-[(4-fluorophenyl)methylideneamino]-4H-thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | O=C(NN=Cc1ccc(F)cc1)c1cc2sccc2[nH]1 |
| InChI | InChI=1S/C14H10FN3OS/c15-10-3-1-9(2-4-10)8-16-18-14(19)12-7-13-11(17-12)5-6-20-13/h1-8,17H,(H,18,19) |
| InChIKey | LIGWKZGLBVXNAY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|