C22H29N3O2S — CID 3228491
1-(5,6-dihydro-4H-1,3-thiazin-2-yl)-1-(5,6-dimethylhepta-1,3,5-trien-4-yl)-3-(2-ethoxyphenyl)urea (PubChem CID 3228491) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-(5,6-dihydro-4H-1,3-thiazin-2-yl)-1-(5,6-dimethylhepta-1,3,5-trien-4-yl)-3-(2-ethoxyphenyl)urea.
| Compound Name | 1-(5,6-dihydro-4H-1,3-thiazin-2-yl)-1-(5,6-dimethylhepta-1,3,5-trien-4-yl)-3-(2-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 3228491 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-(5,6-dihydro-4H-1,3-thiazin-2-yl)-1-(5,6-dimethylhepta-1,3,5-trien-4-yl)-3-(2-ethoxyphenyl)urea |
| SMILES | C=CC=C(C(C)=C(C)C)N(C(=O)Nc1ccccc1OCC)C1=NCCCS1 |
| InChI | InChI=1S/C22H29N3O2S/c1-6-11-19(17(5)16(3)4)25(22-23-14-10-15-28-22)21(26)24-18-12-8-9-13-20(18)27-7-2/h6,8-9,11-13H,1,7,10,14-15H2,2-5H3,(H,24,26) |
| InChIKey | YFVFAHABRIMZKP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|