C24H27N3O — CID 3228642
[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-diphenylmethanol (PubChem CID 3228642) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is [1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-diphenylmethanol.
| Compound Name | [1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 3228642 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | [1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-diphenylmethanol |
| SMILES | Cc1cc(N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)nc(C)n1 |
| InChI | InChI=1S/C24H27N3O/c1-18-17-23(26-19(2)25-18)27-15-13-22(14-16-27)24(28,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,17,22,28H,13-16H2,1-2H3 |
| InChIKey | UDINWFLUBMNJTK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |