C17H25N5O3 — CID 3228815
1-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-(2-methoxyphenyl)piperidin-4-ol (PubChem CID 3228815) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-(2-methoxyphenyl)piperidin-4-ol.
| Compound Name | 1-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-(2-methoxyphenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 3228815 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-(2-methoxyphenyl)piperidin-4-ol |
| SMILES | COCCn1nnnc1CN1CCC(O)(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C17H25N5O3/c1-24-12-11-22-16(18-19-20-22)13-21-9-7-17(23,8-10-21)14-5-3-4-6-15(14)25-2/h3-6,23H,7-13H2,1-2H3 |
| InChIKey | JPGSTPVSIZGKHI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |