C21H24FN7 — CID 3229303
2-[[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-pyridin-2-ylmethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 3229303) has the molecular formula C21H24FN7 and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-pyridin-2-ylmethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-pyridin-2-ylmethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 3229303 |
| Molecular Formula | C21H24FN7 |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-[[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-pyridin-2-ylmethyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Fc1ccc(Cn2nnnc2C(c2ccccn2)N2CCN3CCCC3C2)cc1 |
| InChI | InChI=1S/C21H24FN7/c22-17-8-6-16(7-9-17)14-29-21(24-25-26-29)20(19-5-1-2-10-23-19)28-13-12-27-11-3-4-18(27)15-28/h1-2,5-10,18,20H,3-4,11-15H2 |
| InChIKey | OTHCPXKPELBAAZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |