C18H19N7OS — CID 3232700
3-[2-(4-methylpiperazin-1-yl)-7-oxo-6-thiophen-2-ylpteridin-8-yl]propanenitrile (PubChem CID 3232700) has the molecular formula C18H19N7OS and a molecular weight of 381.47 g/mol. Its IUPAC name is 3-[2-(4-methylpiperazin-1-yl)-7-oxo-6-thiophen-2-ylpteridin-8-yl]propanenitrile.
| Compound Name | 3-[2-(4-methylpiperazin-1-yl)-7-oxo-6-thiophen-2-ylpteridin-8-yl]propanenitrile |
|---|---|
| PubChem CID | 3232700 |
| Molecular Formula | C18H19N7OS |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 3-[2-(4-methylpiperazin-1-yl)-7-oxo-6-thiophen-2-ylpteridin-8-yl]propanenitrile |
| SMILES | CN1CCN(c2ncc3nc(-c4cccs4)c(=O)n(CCC#N)c3n2)CC1 |
| InChI | InChI=1S/C18H19N7OS/c1-23-7-9-24(10-8-23)18-20-12-13-16(22-18)25(6-3-5-19)17(26)15(21-13)14-4-2-11-27-14/h2,4,11-12H,3,6-10H2,1H3 |
| InChIKey | GEKPMVDOUWQWJY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 90.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |