C13H18N6O — CID 3232710
6,8-dimethyl-2-(4-methylpiperazin-1-yl)pteridin-7-one (PubChem CID 3232710) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is 6,8-dimethyl-2-(4-methylpiperazin-1-yl)pteridin-7-one.
| Compound Name | 6,8-dimethyl-2-(4-methylpiperazin-1-yl)pteridin-7-one |
|---|---|
| PubChem CID | 3232710 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 6,8-dimethyl-2-(4-methylpiperazin-1-yl)pteridin-7-one |
| SMILES | Cc1nc2cnc(N3CCN(C)CC3)nc2n(C)c1=O |
| InChI | InChI=1S/C13H18N6O/c1-9-12(20)18(3)11-10(15-9)8-14-13(16-11)19-6-4-17(2)5-7-19/h8H,4-7H2,1-3H3 |
| InChIKey | SKDFBHSIJNHDMR-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |