C15H22N4O — CID 3234494
1-(2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecan-9-yl)ethanone (PubChem CID 3234494) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 1-(2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecan-9-yl)ethanone.
| Compound Name | 1-(2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecan-9-yl)ethanone |
|---|---|
| PubChem CID | 3234494 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 1-(2-pyrimidin-2-yl-2,9-diazaspiro[5.5]undecan-9-yl)ethanone |
| SMILES | CC(=O)N1CCC2(CCCN(c3ncccn3)C2)CC1 |
| InChI | InChI=1S/C15H22N4O/c1-13(20)18-10-5-15(6-11-18)4-2-9-19(12-15)14-16-7-3-8-17-14/h3,7-8H,2,4-6,9-12H2,1H3 |
| InChIKey | CAFJNMSPGKZSPC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |