C21H25N5O3S — CID 3235161
N-[3-[4-(2-morpholin-4-ylethylamino)quinazolin-6-yl]phenyl]methanesulfonamide (PubChem CID 3235161) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[3-[4-(2-morpholin-4-ylethylamino)quinazolin-6-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[4-(2-morpholin-4-ylethylamino)quinazolin-6-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 3235161 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[3-[4-(2-morpholin-4-ylethylamino)quinazolin-6-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2ccc3ncnc(NCCN4CCOCC4)c3c2)c1 |
| InChI | InChI=1S/C21H25N5O3S/c1-30(27,28)25-18-4-2-3-16(13-18)17-5-6-20-19(14-17)21(24-15-23-20)22-7-8-26-9-11-29-12-10-26/h2-6,13-15,25H,7-12H2,1H3,(H,22,23,24) |
| InChIKey | PBFFHGRTFIRIGK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |