C23H32N4O4 — CID 3236302
ethyl 4-[2-[3-[benzyl(ethyl)amino]propylamino]-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate (PubChem CID 3236302) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is ethyl 4-[2-[3-[benzyl(ethyl)amino]propylamino]-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[3-[benzyl(ethyl)amino]propylamino]-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 3236302 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | ethyl 4-[2-[3-[benzyl(ethyl)amino]propylamino]-3,4-dioxocyclobuten-1-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2c(NCCCN(CC)Cc3ccccc3)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C23H32N4O4/c1-3-25(17-18-9-6-5-7-10-18)12-8-11-24-19-20(22(29)21(19)28)26-13-15-27(16-14-26)23(30)31-4-2/h5-7,9-10,24H,3-4,8,11-17H2,1-2H3 |
| InChIKey | MYFVWGDYJNFUHQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|