C19H29N3O3S — CID 3236510
N-[2-(4-methylphenyl)ethyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide (PubChem CID 3236510) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[2-(4-methylphenyl)ethyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(4-methylphenyl)ethyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3236510 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[2-(4-methylphenyl)ethyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(CCNC(=O)C2CCN(S(=O)(=O)N3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C19H29N3O3S/c1-16-4-6-17(7-5-16)8-11-20-19(23)18-9-14-22(15-10-18)26(24,25)21-12-2-3-13-21/h4-7,18H,2-3,8-15H2,1H3,(H,20,23) |
| InChIKey | LXRDHBLLOJHXJG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |