C17H12N2O2 — CID 3237127
4-phenyl-3,4-dihydro-1H-indeno[1,2-d]pyrimidine-2,5-dione (PubChem CID 3237127) has the molecular formula C17H12N2O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-phenyl-3,4-dihydro-1H-indeno[1,2-d]pyrimidine-2,5-dione.
| Compound Name | 4-phenyl-3,4-dihydro-1H-indeno[1,2-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 3237127 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-phenyl-3,4-dihydro-1H-indeno[1,2-d]pyrimidine-2,5-dione |
| SMILES | O=C1NC2=C(C(=O)c3ccccc32)C(c2ccccc2)N1 |
| InChI | InChI=1S/C17H12N2O2/c20-16-12-9-5-4-8-11(12)15-13(16)14(18-17(21)19-15)10-6-2-1-3-7-10/h1-9,14H,(H2,18,19,21) |
| InChIKey | ISEKSXKHQRZFJA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |