C19H16N2O2 — CID 11220435
6-(3-aminopropyl)indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 11220435) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 6-(3-aminopropyl)indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-(3-aminopropyl)indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 11220435 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 6-(3-aminopropyl)indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | NCCCn1c2c(c3ccccc3c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C19H16N2O2/c20-10-5-11-21-17-13-7-2-3-8-14(13)18(22)16(17)12-6-1-4-9-15(12)19(21)23/h1-4,6-9H,5,10-11,20H2 |
| InChIKey | JWMIPWLLAVVHDH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|