C14H11NO3 — CID 6604934
3,3-dimethyl-1H-benzo[g]indole-2,4,5-trione (PubChem CID 6604934) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 3,3-dimethyl-1H-benzo[g]indole-2,4,5-trione.
| Compound Name | 3,3-dimethyl-1H-benzo[g]indole-2,4,5-trione |
|---|---|
| PubChem CID | 6604934 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 3,3-dimethyl-1H-benzo[g]indole-2,4,5-trione |
| SMILES | CC1(C)C(=O)NC2=C1C(=O)C(=O)c1ccccc12 |
| InChI | InChI=1S/C14H11NO3/c1-14(2)9-10(15-13(14)18)7-5-3-4-6-8(7)11(16)12(9)17/h3-6H,1-2H3,(H,15,18) |
| InChIKey | LLPBUXODFQZPFH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|