C14H15N3O6S — CID 3237623
ethyl 3-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]benzoate (PubChem CID 3237623) has the molecular formula C14H15N3O6S and a molecular weight of 353.36 g/mol. Its IUPAC name is ethyl 3-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]benzoate.
| Compound Name | ethyl 3-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 3237623 |
| Molecular Formula | C14H15N3O6S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | ethyl 3-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NS(=O)(=O)c2c(C)[nH]c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C14H15N3O6S/c1-3-23-13(19)9-5-4-6-10(7-9)17-24(21,22)11-8(2)15-14(20)16-12(11)18/h4-7,17H,3H2,1-2H3,(H2,15,16,18,20) |
| InChIKey | POBAGZNPJVIKGO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |