C13H16N2O2S2 — CID 3238598
N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethanesulfonamide (PubChem CID 3238598) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethanesulfonamide.
| Compound Name | N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 3238598 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H16N2O2S2/c1-2-19(16,17)14-9-8-12-10-18-13(15-12)11-6-4-3-5-7-11/h3-7,10,14H,2,8-9H2,1H3 |
| InChIKey | HRCNTNJTBZXKLI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |