C12H24N2O6 — CID 3238714
2-hydroxy-N-[2-[2-[2-(2-hydroxypropanoylamino)ethoxy]ethoxy]ethyl]propanamide (PubChem CID 3238714) has the molecular formula C12H24N2O6 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-hydroxy-N-[2-[2-[2-(2-hydroxypropanoylamino)ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2-hydroxy-N-[2-[2-[2-(2-hydroxypropanoylamino)ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 3238714 |
| Molecular Formula | C12H24N2O6 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-hydroxy-N-[2-[2-[2-(2-hydroxypropanoylamino)ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC(O)C(=O)NCCOCCOCCNC(=O)C(C)O |
| InChI | InChI=1S/C12H24N2O6/c1-9(15)11(17)13-3-5-19-7-8-20-6-4-14-12(18)10(2)16/h9-10,15-16H,3-8H2,1-2H3,(H,13,17)(H,14,18) |
| InChIKey | DMHQAQIDRHQQRB-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|