C15H29FN2O5 — CID 142623180
N-[2-fluoro-3-[2-[2-[(2-propan-2-yloxyacetyl)amino]ethoxy]ethoxy]propyl]propanamide (PubChem CID 142623180) has the molecular formula C15H29FN2O5 and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-[(2-propan-2-yloxyacetyl)amino]ethoxy]ethoxy]propyl]propanamide.
| Compound Name | N-[2-fluoro-3-[2-[2-[(2-propan-2-yloxyacetyl)amino]ethoxy]ethoxy]propyl]propanamide |
|---|---|
| PubChem CID | 142623180 |
| Molecular Formula | C15H29FN2O5 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-[(2-propan-2-yloxyacetyl)amino]ethoxy]ethoxy]propyl]propanamide |
| SMILES | CCC(=O)NCC(F)COCCOCCNC(=O)COC(C)C |
| InChI | InChI=1S/C15H29FN2O5/c1-4-14(19)18-9-13(16)10-22-8-7-21-6-5-17-15(20)11-23-12(2)3/h12-13H,4-11H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | MXCFQDSYJBPJNV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|