C15H12N2O3S — CID 3239232
N-(1,3-benzodioxol-5-yl)-6-methoxy-1,3-benzothiazol-2-amine (PubChem CID 3239232) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-methoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-methoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 3239232 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-methoxy-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(Nc3ccc4c(c3)OCO4)sc2c1 |
| InChI | InChI=1S/C15H12N2O3S/c1-18-10-3-4-11-14(7-10)21-15(17-11)16-9-2-5-12-13(6-9)20-8-19-12/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | DULCAPQAGNFPDI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |