C20H17F2NO4S — CID 3239272
N-[(4-fluorophenyl)methyl]-5-[(4-fluorophenyl)methylsulfonylmethyl]furan-2-carboxamide (PubChem CID 3239272) has the molecular formula C20H17F2NO4S and a molecular weight of 405.42 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-5-[(4-fluorophenyl)methylsulfonylmethyl]furan-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-5-[(4-fluorophenyl)methylsulfonylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3239272 |
| Molecular Formula | C20H17F2NO4S |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-5-[(4-fluorophenyl)methylsulfonylmethyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc(CS(=O)(=O)Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H17F2NO4S/c21-16-5-1-14(2-6-16)11-23-20(24)19-10-9-18(27-19)13-28(25,26)12-15-3-7-17(22)8-4-15/h1-10H,11-13H2,(H,23,24) |
| InChIKey | PNNGONYDLJJCBL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |