C24H26N4O3 — CID 3239606
methyl 2-[[1-(4-ethylpiperazin-1-yl)isoquinoline-4-carbonyl]amino]benzoate (PubChem CID 3239606) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is methyl 2-[[1-(4-ethylpiperazin-1-yl)isoquinoline-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[1-(4-ethylpiperazin-1-yl)isoquinoline-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 3239606 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | methyl 2-[[1-(4-ethylpiperazin-1-yl)isoquinoline-4-carbonyl]amino]benzoate |
| SMILES | CCN1CCN(c2ncc(C(=O)Nc3ccccc3C(=O)OC)c3ccccc23)CC1 |
| InChI | InChI=1S/C24H26N4O3/c1-3-27-12-14-28(15-13-27)22-18-9-5-4-8-17(18)20(16-25-22)23(29)26-21-11-7-6-10-19(21)24(30)31-2/h4-11,16H,3,12-15H2,1-2H3,(H,26,29) |
| InChIKey | WUCYLECPMWLREK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |