About ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate
ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate (PubChem CID 3240210) has the molecular formula C11H13N3O3
and a molecular weight of 235.24 g/mol. Its IUPAC name is ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate.
Analyze ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate?
The IUPAC name of ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate (CID 3240210) is ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate.
What is the SMILES notation for ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate?
The canonical SMILES for ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate is CCOC(=O)C(C)n1ncn2cccc2c1=O.
What is the InChIKey of ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate?
The InChIKey is ZAHQZEUBRUBTNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3/c1-3-17-11(16)8(2)14-10(15)9-5-4-6-13(9)7-12-14/h4-8H,3H2,1-2H3.
What are the key properties of ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate?
ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate has a molecular weight of 235.24 g/mol, XLogP of 0.62, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)propanoate is sourced from PubChem (CID 3240210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).