C18H23NO5S — CID 3240384
N-(3-methoxypropyl)-5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carboxamide (PubChem CID 3240384) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is N-(3-methoxypropyl)-5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carboxamide.
| Compound Name | N-(3-methoxypropyl)-5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3240384 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-(3-methoxypropyl)-5-[(3-methylphenyl)methylsulfonylmethyl]furan-2-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(CS(=O)(=O)Cc2cccc(C)c2)o1 |
| InChI | InChI=1S/C18H23NO5S/c1-14-5-3-6-15(11-14)12-25(21,22)13-16-7-8-17(24-16)18(20)19-9-4-10-23-2/h3,5-8,11H,4,9-10,12-13H2,1-2H3,(H,19,20) |
| InChIKey | QQIRXMOHCDMRAO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|